N-benzyl-4-nitrobenzenamine structure
|
Common Name | N-benzyl-4-nitrobenzenamine | ||
|---|---|---|---|---|
| CAS Number | 14309-92-3 | Molecular Weight | 228.24700 | |
| Density | 1.258g/cm3 | Boiling Point | 392ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.9ºC | |
| Name | N-benzyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 392ºC at 760 mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 190.9ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 3.80310 |
| Vapour Pressure | 2.36E-06mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | QBSRKOBMKFOHOS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2)cc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 238-249-4 |
| N-benzyl-4-nitrobenzenamine |
| 4-O2NC6H4NHCH2Ph |
| p-Nitro-N-benzylaniline |