1,3-Cyclopentadiene,1,2,3,4,5,5-hexabromo- structure
|
Common Name | 1,3-Cyclopentadiene,1,2,3,4,5,5-hexabromo- | ||
|---|---|---|---|---|
| CAS Number | 14310-17-9 | Molecular Weight | 539.47800 | |
| Density | 3.552g/cm3 | Boiling Point | 303.9ºC at 760 mmHg | |
| Molecular Formula | C5Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
| Name | 1,2,3,4,5,5-hexabromocyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 3.552g/cm3 |
|---|---|
| Boiling Point | 303.9ºC at 760 mmHg |
| Molecular Formula | C5Br6 |
| Molecular Weight | 539.47800 |
| Flash Point | 135.1ºC |
| Exact Mass | 533.51000 |
| LogP | 5.48890 |
| Vapour Pressure | 0.00163mmHg at 25°C |
| Index of Refraction | 1.867 |
| InChIKey | NUYUCYZVFLZIPX-UHFFFAOYSA-N |
| SMILES | BrC1=C(Br)C(Br)(Br)C(Br)=C1Br |
|
~%
1,3-Cyclopentad... CAS#:14310-17-9 |
| Literature: Ungefug,G.A.; Roberts,C.W. Journal of Organic Chemistry, 1973 , vol. 38, p. 153 - 155 |
|
~%
1,3-Cyclopentad... CAS#:14310-17-9 |
| Literature: Riemschneider Chimica e l'Industria (Milan, Italy), 1952 , vol. 34, p. 266 |
| hexabromo-1,3-cyclopentadiene |
| Hexabromcyclopentadien |
| hexabromocyclopentene |
| hexabromo-cyclopenta-1,3-diene |
| 1,1,2,3,4,5,5-hexabromo |
| Hexabrom-cyclopenta-1,3-dien |
| hexabromocyclopentadiene |