4-Methoxyphenylcarbamic acid 4-iodo-2-butynyl ester structure
|
Common Name | 4-Methoxyphenylcarbamic acid 4-iodo-2-butynyl ester | ||
|---|---|---|---|---|
| CAS Number | 14313-51-0 | Molecular Weight | 345.13300 | |
| Density | 1.687g/cm3 | Boiling Point | 376.6ºC at 760 mmHg | |
| Molecular Formula | C12H12INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.5ºC | |
| Name | 4-iodobut-2-ynyl N-(4-methoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.687g/cm3 |
|---|---|
| Boiling Point | 376.6ºC at 760 mmHg |
| Molecular Formula | C12H12INO3 |
| Molecular Weight | 345.13300 |
| Flash Point | 181.5ºC |
| Exact Mass | 344.98600 |
| PSA | 47.56000 |
| LogP | 2.75510 |
| Vapour Pressure | 7.18E-06mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | HLSLTRJZIMUVRV-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)OCC#CCI)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| CARBANILIC ACID,p-METHOXY-,4-IODO-2-BUTYNYL ESTER |
| 4-Iodo-2-butynyl p-methoxycarbanilate |
| p-Methoxycarbanilic acid 4-iodo-2-butynyl ester |