(Z)-Azoxystrobin structure
|
Common Name | (Z)-Azoxystrobin | ||
|---|---|---|---|---|
| CAS Number | 143130-94-3 | Molecular Weight | 403.388 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 581.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3±30.1 °C | |
Use of (Z)-AzoxystrobinAzoxystrobin is a systemic, broad-spectrum fungicide belonging to the class of methoxyacrylates,which are derived from the naturally-occurring strobilurins. |
| Name | Methyl (2Z)-2-(2-{[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy}phenyl)-3-methoxyacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.3±50.0 °C at 760 mmHg |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.388 |
| Flash Point | 305.3±30.1 °C |
| Exact Mass | 403.116821 |
| LogP | 5.13 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | WFDXOXNFNRHQEC-LGMDPLHJSA-N |
| SMILES | COC=C(C(=O)OC)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1 |
| Storage condition | -20℃ |
| Methyl (2Z)-2-(2-{[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy}phenyl)-3-methoxyacrylate |
| T6N CNJ DOR BYVO1&U1O1& FOR BCN &&Z Form |
| (2Z)-2-(2-{[6-(2-Cyanophénoxy)-4-pyrimidinyl]oxy}phényl)-3-méthoxyacrylate de méthyle |
| Benzeneacetic acid, 2-[[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene)-, methyl ester, (αZ)- |
| Methyl-(2Z)-2-(2-{[6-(2-cyanphenoxy)-4-pyrimidinyl]oxy}phenyl)-3-methoxyacrylat |