Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester
Modify Date: 2025-08-24 00:15:57
Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester structure
|
Common Name | Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 1431612-29-1 | Molecular Weight | 317.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrO3S |
|---|---|
| Molecular Weight | 317.20 |
| InChIKey | CZNKBJLXLZSTRN-UHFFFAOYSA-N |
| SMILES | C#CCCCCOS(=O)(=O)c1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1431612-29-1? |
| A: Chinese name of 1431612-29-1 is 1431612-29-1. |
| Q: What is the molecular formula of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: Molecular formula of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is C12H13BrO3S. |
| Q: What is the CAS number of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: CAS number of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is 1431612-29-1. |
| Q: What is the SMILES notation of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: SMILES notation of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is C#CCCCCOS(=O)(=O)c1ccc(Br)cc1. |
| Q: What is the English name of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: The English name of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester. |
| Q: What is the molecular weight of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: Molecular weight of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is 317.20. |
| Q: What is the InChIKey of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester? |
| A: InChIKey of Benzenesulfonic acid, 4-bromo-, 5-hexyn-1-yl ester is CZNKBJLXLZSTRN-UHFFFAOYSA-N. |