PACA structure
|
Common Name | PACA | ||
|---|---|---|---|---|
| CAS Number | 1431724-30-9 | Molecular Weight | 217.221 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 503.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 258.5±30.1 °C | |
Use of PACAPACA, also known as N-Propargyl Caffeamide, potentiates NGF-induced neurite outgrowth and attenuates 6-hydroxydopamine neurotoxicity in neuronal culture. Insufficient production of nerve growth factor (NGF) is implicated in Parkinson's disease (PD). |
| Name | PACA |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.9±50.0 °C at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.221 |
| Flash Point | 258.5±30.1 °C |
| Exact Mass | 217.073898 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | HLHSUNWAPXINQU-GQCTYLIASA-N |
| SMILES | C#CCNC(=O)C=Cc1ccc(O)c(O)c1 |
| RIDADR | NONH for all modes of transport |
|---|
| (2E)-3-(3,4-Dihydroxyphenyl)-N-(2-propyn-1-yl)acrylamide |
| 2-Propenamide, 3-(3,4-dihydroxyphenyl)-N-2-propyn-1-yl-, (2E)- |
| PACA |
| 3-(3,4-Dihydroxyphenyl)-N-2-propyn-1-yl-2-propenamide |