butan-2-yl N-(4-nitrophenyl)carbamate
Modify Date: 2025-10-28 16:39:34
butan-2-yl N-(4-nitrophenyl)carbamate structure
|
Common Name | butan-2-yl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 143194-01-8 | Molecular Weight | 238.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butan-2-yl N-(4-nitrophenyl)carbamate |
|---|
| Molecular Formula | C11H14N2O4 |
|---|---|
| Molecular Weight | 238.24000 |
| Exact Mass | 238.09500 |
| PSA | 84.15000 |
| LogP | 3.53800 |
| InChIKey | WDRYVPQIJZOKFQ-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
butan-2-yl N-(4... CAS#:143194-01-8 |
| Literature: Shriner; Cox Journal of the American Chemical Society, 1931 , vol. 53, p. 1602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |