bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate structure
|
Common Name | bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate | ||
|---|---|---|---|---|
| CAS Number | 1432-14-0 | Molecular Weight | 319.78100 | |
| Density | N/A | Boiling Point | 331.9ºC at 760 mmHg | |
| Molecular Formula | C14H22ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5ºC | |
| Name | mecoprop-diolamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 331.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.78100 |
| Flash Point | 154.5ºC |
| Exact Mass | 319.11900 |
| PSA | 99.02000 |
| LogP | 1.45180 |
| Vapour Pressure | 6.04E-05mmHg at 25°C |
| InChIKey | CGFQAAGKJZMVNF-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)O.OCCNCCO |
| 2-(4-chloro-2-methylphenoxy)propanoic acid,2-(2-hydroxyethylamino)ethanol |
| Mecoprop-diolamine [ISO] |
| (RS)-2-(4-chloro-o-tolyloxy)propionic acid - 2,2’-iminodiethanol (1:1) |
| Diethanolamine 2-(2-methyl-4-chlorophenoxy)propionate |
| 2-(2-Methyl-4-chlorophenoxy)propionic acid,diethanolamine salt |
| bis(2-hydroxyethyl)ammonium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| EINECS 215-856-2 |
| Mecoprop-diolamine |
| rac-(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—2,2’-azanediyldi(ethan-1-ol) |
| Mecoprop diethanolamine salt |
| Ethanol,2,2-iminodi-,compd. with 2-((4-chloro-o-tolyl)oxy)propionic acid (1:1) |
| Propionic acid,2-((4-chloro-o-tolyl)oxy)-,compd. with 2,2'-iminodiethanol (1:1) |
| 2-(4-chloro-2-methylphenoxy)propanoic acid compound with 2,2’-iminobis[ethanol] (1:1) |
| Bis(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate |