ethyl 3-[2-(2-ethoxy-2-oxoethyl)phenyl]propanoate structure
|
Common Name | ethyl 3-[2-(2-ethoxy-2-oxoethyl)phenyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 143260-87-1 | Molecular Weight | 264.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-[2-(2-ethoxy-2-oxoethyl)phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O4 |
|---|---|
| Molecular Weight | 264.31700 |
| Exact Mass | 264.13600 |
| PSA | 52.60000 |
| LogP | 2.28790 |
| InChIKey | WQKZDJNPCRAQLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1ccccc1CC(=O)OCC |
|
~%
ethyl 3-[2-(2-e... CAS#:143260-87-1 |
| Literature: Cope,A.C.; Fordice,M.W. Journal of the American Chemical Society, 1967 , vol. 89, p. 6187 - 6191 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| o-Carbaethoxymethyl-hydrozimtsaeure-aethylester |