1-(3-Bromophenyl)cyclopentanecarboxylic acid structure
|
Common Name | 1-(3-Bromophenyl)cyclopentanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 143328-23-8 | Molecular Weight | 269.134 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 392.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.0±25.9 °C | |
| Name | 1-(3-bromophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.1±35.0 °C at 760 mmHg |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.134 |
| Flash Point | 191.0±25.9 °C |
| Exact Mass | 268.009888 |
| PSA | 37.30000 |
| LogP | 3.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | LYXFHQXQIYWCHA-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2cccc(Br)c2)CCCC1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(3-Bromophenyl)cyclopentanecarboxylic acid |
| Cyclopentanecarboxylic acid, 1-(3-bromophenyl)- |
| Cyclopentanecarboxylic acid,1-(3-bromophenyl) |