6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol structure
|
Common Name | 6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol | ||
|---|---|---|---|---|
| CAS Number | 143343-83-3 | Molecular Weight | 384.42600 | |
| Density | 1.236g/cm3 | Boiling Point | 661.8ºC at 760mmHg | |
| Molecular Formula | C21H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354ºC | |
| Name | 6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 661.8ºC at 760mmHg |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.42600 |
| Flash Point | 354ºC |
| Exact Mass | 384.16900 |
| PSA | 92.81000 |
| LogP | 2.46570 |
| Vapour Pressure | 2.05E-18mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | BYKYPZBCMBEEGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNCC(O)COc2ccc3[nH]c(=O)ccc3c2)cc1OC |
|
~%
6-{3-[(3,4-Dime... CAS#:143343-83-3 |
| Literature: Fujioka; Teramoto; Mori; Hosokawa; Sumida; Tominaga; Yabuuchi Journal of Medicinal Chemistry, 1992 , vol. 35, # 20 p. 3607 - 3612 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |