merodantoin structure
|
Common Name | merodantoin | ||
|---|---|---|---|---|
| CAS Number | 143413-73-4 | Molecular Weight | 242.34 | |
| Density | 1.18g/cm3 | Boiling Point | 309ºC at 760mmHg | |
| Molecular Formula | C11H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of merodantoinMerodantoin has significant antitumor activity in vitro and in vivo, and has less toxicity to normal cells and tissues[1]. |
| Name | 1,3-dibutyl-2-sulfanylideneimidazolidine-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Merodantoin has significant antitumor activity in vitro and in vivo, and has less toxicity to normal cells and tissues[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 309ºC at 760mmHg |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 |
| Exact Mass | 242.10900 |
| PSA | 72.71000 |
| LogP | 1.41810 |
| Vapour Pressure | 0.000658mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | XUHLNLNNPFTDLA-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C(=O)N(CCCC)C1=S |
| 1,3-Dibutyl-2-thioxo-4,5-imidazolidinedione |
| 4,5-Imidazolidinedione,1,3-dibutyl-2-thioxo |
| N,N'-Dibutyl-2-thio-4,5-imidazolidion |
| Merodantoin |