3'-Hydroxy-5'-(4-ethyl-1-piperazinyl)benzoxazinorifamycin
Modify Date: 2025-08-23 06:18:55
3'-Hydroxy-5'-(4-ethyl-1-piperazinyl)benzoxazinorifamycin structure
|
Common Name | 3'-Hydroxy-5'-(4-ethyl-1-piperazinyl)benzoxazinorifamycin | ||
|---|---|---|---|---|
| CAS Number | 143526-65-2 | Molecular Weight | 913.02000 | |
| Density | 1.39g/cm3 | Boiling Point | 1042.769ºC at 760 mmHg | |
| Molecular Formula | C49H60N4O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 584.446ºC | |
| Name | 3'-Hydroxy-5'-(4-ethyl-1-piperazinyl)benzoxazinorifamycin |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 1042.769ºC at 760 mmHg |
| Molecular Formula | C49H60N4O13 |
| Molecular Weight | 913.02000 |
| Flash Point | 584.446ºC |
| Exact Mass | 912.41600 |
| PSA | 233.89000 |
| LogP | 4.27700 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | RSGFXVPMCMCRDH-WVDMLYERSA-N |
| SMILES | CCN1CCN(c2cc(=O)c3nc4c(oc3c2)c2c(=O)c3c(O)c(C)c5c(c34)=C(O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O5)CC1 |
|
~%
3'-Hydroxy-5'-(... CAS#:143526-65-2 |
| Literature: Li, Jing; Ma, Zhenkun; Chapo, Katrina; Yan, Dalai; Lynch, A. Simon; Ding, Charles Z. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 20 p. 5510 - 5513 |
|
~%
3'-Hydroxy-5'-(... CAS#:143526-65-2 |
| Literature: Yamane; Hashizume; Yamashita; Konishi; Hosoe; Hidaka; Watanabe; Kawaharada; Yamamoto; Kuze Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 1 p. 148 - 155 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |