1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethanone structure
|
Common Name | 1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 143543-83-3 | Molecular Weight | 271.78600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethanone |
|---|
| Molecular Formula | C11H10ClNOS2 |
|---|---|
| Molecular Weight | 271.78600 |
| Exact Mass | 270.98900 |
| PSA | 80.03000 |
| LogP | 2.79430 |
| InChIKey | MKBJBPCBPAJWIV-UHFFFAOYSA-N |
| SMILES | O=C(CSC1=NCCS1)c1ccc(Cl)cc1 |
|
~94%
1-(4-chlorophen... CAS#:143543-83-3 |
| Literature: Loghmani-Khouzani, Hossein; Hajiheidari, Dariush Journal of Fluorine Chemistry, 2010 , vol. 131, # 5 p. 561 - 569 |
|
~64%
1-(4-chlorophen... CAS#:143543-83-3 |
| Literature: Hirashima, Akinori; Yoshii, Yutaka; Eto, Morifusa Bioscience, Biotechnology, and Biochemistry, 1992 , vol. 56, # 7 p. 1062 - 1065 |