Cannabidiol-D3
Modify Date: 2025-09-09 18:34:50
Cannabidiol-D3 structure
|
Common Name | Cannabidiol-D3 | ||
|---|---|---|---|---|
| CAS Number | 1435783-16-6 | Molecular Weight | 317.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cannabidiol-D3 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H30O2 |
|---|---|
| Molecular Weight | 317.5 |
| InChIKey | QHMBSVQNZZTUGM-GBXVFRIQSA-N |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Cannabidiol-D3? |
| A: CAS number of Cannabidiol-D3 is 1435783-16-6. |
| Q: What is the Chinese name of 1435783-16-6? |
| A: Chinese name of 1435783-16-6 is 1435783-16-6. |
| Q: What is the English name of Cannabidiol-D3? |
| A: The English name of Cannabidiol-D3 is Cannabidiol-D3. |
| Q: What is the molecular formula of Cannabidiol-D3? |
| A: Molecular formula of Cannabidiol-D3 is C21H30O2. |
| Q: What is the molecular weight of Cannabidiol-D3? |
| A: Molecular weight of Cannabidiol-D3 is 317.5. |
| Q: What is the SMILES notation of Cannabidiol-D3? |
| A: SMILES notation of Cannabidiol-D3 is C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1O. |
| Q: What is the InChIKey of Cannabidiol-D3? |
| A: InChIKey of Cannabidiol-D3 is QHMBSVQNZZTUGM-GBXVFRIQSA-N. |