Meprobamate-d7 structure
|
Common Name | Meprobamate-d7 | ||
|---|---|---|---|---|
| CAS Number | 1435933-83-7 | Molecular Weight | 225.293 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 434.2±28.0 °C at 760 mmHg | |
| Molecular Formula | C9H11D7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.7±20.3 °C | |
Use of Meprobamate-d7Meprobamate-d7 is an analytical reference standard intended for use as an internal standard for the quantification of meprobamate by GC- or LC-MS. |
| Name | 2-[(Carbamoyloxy)methyl]-2-methyl(3,3,4,4,5,5,5-2H7)pentyl carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.2±28.0 °C at 760 mmHg |
| Molecular Formula | C9H11D7N2O4 |
| Molecular Weight | 225.293 |
| Flash Point | 229.7±20.3 °C |
| Exact Mass | 225.170593 |
| LogP | 0.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | NPPQSCRMBWNHMW-SSQNFVSCSA-N |
| SMILES | CCCC(C)(COC(N)=O)COC(N)=O |
| 1,3-Propanediol, 2-methyl-2-(propyl-d7)-, dicarbamate |
| 2-[(Carbamoyloxy)methyl]-2-methyl(3,3,4,4,5,5,5-2H7)pentyl carbamate |