Ethyl 3-hydroxy-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 3-hydroxy-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 14370-74-2 | Molecular Weight | 205.210 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 369.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3±22.3 °C | |
| Name | ethyl 3-hydroxy-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.5±22.0 °C at 760 mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.210 |
| Flash Point | 177.3±22.3 °C |
| Exact Mass | 205.073898 |
| PSA | 62.32000 |
| LogP | 3.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | XSHRJOVZKKCTIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1O |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-1H-indole-2-carboxylic acid,ethyl ester |
| 3-hydroxy-indole-2-carboxylic acid ethyl ester |
| 3-Hydroxy-indol-2-carbonsaeure-aethylester |
| Ethyl 3-hydroxy-1H-indole-2-carboxylate |
| ethyl 3-hydroxyindole-2-carboxylate |
| Indoxyl-2-carbonsaeureethylester od. 3-Oxoindolin-2-carabonsaeureethylester |
| 2-Carbethoxy-3-hydroxyindol |
| EINECS 238-341-4 |
| 1H-Indole-2-carboxylic acid, 3-hydroxy-, ethyl ester |
| 3-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID ETHYL ESTER |