2-methyl-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-ol structure
|
Common Name | 2-methyl-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 143702-53-8 | Molecular Weight | 238.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-ol |
|---|
| Molecular Formula | C15H14N2O |
|---|---|
| Molecular Weight | 238.28400 |
| Exact Mass | 238.11100 |
| PSA | 48.91000 |
| LogP | 3.11170 |
| InChIKey | DUJXQCCPDNEOQV-UHFFFAOYSA-N |
| SMILES | CC(=Cc1nccc2c1[nH]c1ccccc12)CO |
|
~44%
2-methyl-3-(9H-... CAS#:143702-53-8 |
| Literature: Giri, Venkatachalam S.; Das, Sankar K.; Sankar, Parasuraman Jai; Shoolery, James N.; Keifer, Paul Journal of Heterocyclic Chemistry, 1992 , vol. 29, # 4 p. 767 - 769 |
|
~%
2-methyl-3-(9H-... CAS#:143702-53-8 |
| Literature: Giri, Venkatachalam S.; Das, Sankar K.; Sankar, Parasuraman Jai; Shoolery, James N.; Keifer, Paul Journal of Heterocyclic Chemistry, 1992 , vol. 29, # 4 p. 767 - 769 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |