3-(1-benzothiophen-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one structure
|
Common Name | 3-(1-benzothiophen-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 143707-83-9 | Molecular Weight | 298.40300 | |
| Density | 1.23g/cm3 | Boiling Point | 551.8ºC at 760mmHg | |
| Molecular Formula | C17H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.5ºC | |
| Name | 3-(1-benzothiophen-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 551.8ºC at 760mmHg |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.40300 |
| Flash Point | 287.5ºC |
| Exact Mass | 298.11400 |
| PSA | 73.39000 |
| LogP | 4.55780 |
| Vapour Pressure | 3.18E-12mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | OADBKKYLMLZYPI-UHFFFAOYSA-N |
| SMILES | CCc1cc(NCc2cc3ccccc3s2)c(=O)[nH]c1C |
|
~%
3-(1-benzothiop... CAS#:143707-83-9 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |