5-ethyl-6-methyl-3-(pyridin-2-ylmethylamino)-1H-pyridin-2-one structure
|
Common Name | 5-ethyl-6-methyl-3-(pyridin-2-ylmethylamino)-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 143707-95-3 | Molecular Weight | 243.30400 | |
| Density | 1.15g/cm3 | Boiling Point | 475.6ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.4ºC | |
| Name | 5-ethyl-6-methyl-3-(pyridin-2-ylmethylamino)-1H-pyridin-2-one |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 475.6ºC at 760 mmHg |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.30400 |
| Flash Point | 241.4ºC |
| Exact Mass | 243.13700 |
| PSA | 58.04000 |
| LogP | 2.73810 |
| Vapour Pressure | 3.28E-09mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | IXAOXJKGZNSFFD-UHFFFAOYSA-N |
| SMILES | CCc1cc(NCc2ccccn2)c(=O)[nH]c1C |
|
~%
5-ethyl-6-methy... CAS#:143707-95-3 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |