5-ethyl-3-(1H-indol-3-ylmethylamino)-6-methyl-1H-pyridin-2-one structure
|
Common Name | 5-ethyl-3-(1H-indol-3-ylmethylamino)-6-methyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 143707-96-4 | Molecular Weight | 281.35200 | |
| Density | 1.21g/cm3 | Boiling Point | 577.5ºC at 760mmHg | |
| Molecular Formula | C17H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.1ºC | |
| Name | 5-ethyl-3-(1H-indol-3-ylmethylamino)-6-methyl-1H-pyridin-2-one |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 577.5ºC at 760mmHg |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.35200 |
| Flash Point | 303.1ºC |
| Exact Mass | 281.15300 |
| PSA | 60.94000 |
| LogP | 3.82440 |
| Vapour Pressure | 2.45E-13mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | IVYXCNFPTFUCEQ-UHFFFAOYSA-N |
| SMILES | CCc1cc(NCc2c[nH]c3ccccc23)c(=O)[nH]c1C |
|
~%
5-ethyl-3-(1H-i... CAS#:143707-96-4 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
|
~%
5-ethyl-3-(1H-i... CAS#:143707-96-4 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |