5-ethyl-3-[(6-fluoro-1,3-benzoxazol-2-yl)methylamino]-6-methyl-1H-pyridin-2-one structure
|
Common Name | 5-ethyl-3-[(6-fluoro-1,3-benzoxazol-2-yl)methylamino]-6-methyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 143708-06-9 | Molecular Weight | 301.31600 | |
| Density | 1.3g/cm3 | Boiling Point | 513.1ºC at 760mmHg | |
| Molecular Formula | C16H16FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.1ºC | |
| Name | 5-ethyl-3-[(6-fluoro-1,3-benzoxazol-2-yl)methylamino]-6-methyl-1H-pyridin-2-one |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 513.1ºC at 760mmHg |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.31600 |
| Flash Point | 264.1ºC |
| Exact Mass | 301.12300 |
| PSA | 71.18000 |
| LogP | 3.62340 |
| Vapour Pressure | 1.21E-10mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | APDHUJJIDGNOLY-UHFFFAOYSA-N |
| SMILES | CCc1cc(NCc2nc3ccc(F)cc3o2)c(=O)[nH]c1C |
|
~%
5-ethyl-3-[(6-f... CAS#:143708-06-9 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |