2,3,4,5-Tetrakis(hydroxyimino)cyclopentanone structure
|
Common Name | 2,3,4,5-Tetrakis(hydroxyimino)cyclopentanone | ||
|---|---|---|---|---|
| CAS Number | 14379-01-2 | Molecular Weight | 200.10900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-bis(hydroxyamino)-3,4-dinitrosocyclopenta-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H4N4O5 |
|---|---|
| Molecular Weight | 200.10900 |
| Exact Mass | 200.01800 |
| PSA | 143.94000 |
| LogP | 0.71390 |
| InChIKey | CVEBKZLMFLDGMN-UHFFFAOYSA-N |
| SMILES | O=Nc1c(NO)c(=O)c(=NO)c1=NO |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,3,4,5-Tetrakis(hydroxyimino)cyclopentanone |