(E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid structure
|
Common Name | (E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 143815-47-8 | Molecular Weight | 221.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid |
|---|
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.20900 |
| Exact Mass | 221.06900 |
| PSA | 90.12000 |
| LogP | 1.79410 |
| InChIKey | DDLOBOOFCSYTKW-UXBLZVDNSA-N |
| SMILES | CC(=O)NC(=Cc1cccc(O)c1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
(E)-2-acetamido... CAS#:143815-47-8 |
| Literature: Sealock et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 5386 |
|
~%
(E)-2-acetamido... CAS#:143815-47-8 |
| Literature: Sealock et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 5386 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |