5-Amino-3-ethyl-3-phenyl-2,6(1H,3H)-pyridinedione structure
|
Common Name | 5-Amino-3-ethyl-3-phenyl-2,6(1H,3H)-pyridinedione | ||
|---|---|---|---|---|
| CAS Number | 14387-60-1 | Molecular Weight | 230.26200 | |
| Density | 1.183g/cm3 | Boiling Point | 443.7ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.1ºC | |
| Name | 5-amino-3-ethyl-3-phenylpyridine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 443.7ºC at 760 mmHg |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Flash Point | 222.1ºC |
| Exact Mass | 230.10600 |
| PSA | 75.68000 |
| LogP | 1.80960 |
| Vapour Pressure | 4.55E-08mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | OCFSMAJHEPHKET-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C=C(N)C(=O)NC1=O |
| HS Code | 2925190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-2-ethyl-2-phenylglutaconimide |
| Glutaconimide,2-amino-4-ethyl-4-phenyl |
| 5-amino-3-ethyl-3-phenyl-3H-pyridine-2,6-dione |