4-Acetylamino-5-chloro-2-hydroxy-3-iodobenzoic acid methyl ester structure
|
Common Name | 4-Acetylamino-5-chloro-2-hydroxy-3-iodobenzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 143878-24-4 | Molecular Weight | 369.540 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 423.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H9ClINO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7±28.7 °C | |
| Name | methyl 4-acetamido-5-chloro-2-hydroxy-3-iodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.1±45.0 °C at 760 mmHg |
| Molecular Formula | C10H9ClINO4 |
| Molecular Weight | 369.540 |
| Flash Point | 209.7±28.7 °C |
| Exact Mass | 368.926483 |
| PSA | 79.12000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | KHLJMCYDOCEJNR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c(NC(C)=O)c(I)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 4-acetamido-5-chloro-2-hydroxy-3-iodobenzoate |
| methyl 3-iodo-4-acetamido-5-chloro-salicylate |
| Benzoic acid, 4-(acetylamino)-5-chloro-2-hydroxy-3-iodo-, methyl ester |
| 4-ACETYLAMINO-5-CHLORO-2-HYDROXY-3-IODOBENZOIC ACID METHYL ESTER |