Phosphorimidic-15N trichloride, (p-tolylsulfonyl)
Modify Date: 2026-07-10 10:43:55
Phosphorimidic-15N trichloride, (p-tolylsulfonyl) structure
|
Common Name | Phosphorimidic-15N trichloride, (p-tolylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 14394-82-2 | Molecular Weight | 307.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7Cl3NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phosphorimidic-15N trichloride, (p-tolylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7Cl3NO2PS |
|---|---|
| Molecular Weight | 307.5 |
| InChIKey | PMJOYQDWPXNULW-KHWBWMQUSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N=P(Cl)(Cl)Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: CAS number of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is 14394-82-2. |
| Q: What is the InChIKey of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: InChIKey of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is PMJOYQDWPXNULW-KHWBWMQUSA-N. |
| Q: What is the molecular formula of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: Molecular formula of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is C7H7Cl3NO2PS. |
| Q: What is the SMILES notation of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: SMILES notation of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is Cc1ccc(S(=O)(=O)N=P(Cl)(Cl)Cl)cc1. |
| Q: What is the Chinese name of 14394-82-2? |
| A: Chinese name of 14394-82-2 is 14394-82-2. |
| Q: What is the molecular weight of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: Molecular weight of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is 307.5. |
| Q: What is the English name of Phosphorimidic-15N trichloride, (p-tolylsulfonyl)? |
| A: The English name of Phosphorimidic-15N trichloride, (p-tolylsulfonyl) is Phosphorimidic-15N trichloride, (p-tolylsulfonyl). |