1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid structure
|
Common Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 143978-66-9 | Molecular Weight | 269.33700 | |
| Density | N/A | Boiling Point | 400.9ºC at 760 mmHg | |
| Molecular Formula | C14H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
| Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 400.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.33700 |
| Flash Point | 196.2ºC |
| Exact Mass | 269.16300 |
| PSA | 66.84000 |
| LogP | 2.57710 |
| Vapour Pressure | 1.51E-07mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | POJYGQHOQQDGQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)O)CC2CCCCC21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Boc-L-Octahydroindole-2-carboxylic acid |
| Boc-D-Octahydroindole-2-carboxylic acid |