(2,6-dimethoxyphenyl) 2-bromobutanoate
(2,6-dimethoxyphenyl) 2-bromobutanoate structure
|
Common Name | (2,6-dimethoxyphenyl) 2-bromobutanoate | ||
|---|---|---|---|---|
| CAS Number | 1440-82-0 | Molecular Weight | 303.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,6-dimethoxyphenyl) 2-bromobutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15BrO4 |
|---|---|
| Molecular Weight | 303.14900 |
| Exact Mass | 302.01500 |
| PSA | 44.76000 |
| LogP | 2.78270 |
| InChIKey | SMDSHHLBPUPGTD-UHFFFAOYSA-N |
| SMILES | CCC(Br)C(=O)Oc1c(OC)cccc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Butanoic acid,2-bromo-,2,6-dimethoxyphenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (2,6-dimethoxyphenyl) 2-bromobutanoate have? |
| A: English synonyms of (2,6-dimethoxyphenyl) 2-bromobutanoate: Butanoic acid,2-bromo-,2,6-dimethoxyphenyl ester. |
| Q: What is the Chinese name of 1440-82-0? |
| A: Chinese name of 1440-82-0 is 1440-82-0. |
| Q: What are the upstream materials of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: Related upstream materials(CAS) of (2,6-dimethoxyphenyl) 2-bromobutanoate: 91-10-1;22118-12-3. |
| Q: What is the molecular weight of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: Molecular weight of (2,6-dimethoxyphenyl) 2-bromobutanoate is 303.14900. |
| Q: What is the InChIKey of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: InChIKey of (2,6-dimethoxyphenyl) 2-bromobutanoate is SMDSHHLBPUPGTD-UHFFFAOYSA-N. |
| Q: What is the English name of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: The English name of (2,6-dimethoxyphenyl) 2-bromobutanoate is (2,6-dimethoxyphenyl) 2-bromobutanoate. |
| Q: What is the polar surface area (PSA) of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: Polar surface area (PSA) of (2,6-dimethoxyphenyl) 2-bromobutanoate is 44.76000. |
| Q: What is the SMILES notation of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: SMILES notation of (2,6-dimethoxyphenyl) 2-bromobutanoate is CCC(Br)C(=O)Oc1c(OC)cccc1OC. |
| Q: What is the molecular formula of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: Molecular formula of (2,6-dimethoxyphenyl) 2-bromobutanoate is C12H15BrO4. |
| Q: What is the LogP of (2,6-dimethoxyphenyl) 2-bromobutanoate? |
| A: LogP of (2,6-dimethoxyphenyl) 2-bromobutanoate is 2.78270. |