Benzamide,3,5-dinitro-N-(2-phenylethyl)- structure
|
Common Name | Benzamide,3,5-dinitro-N-(2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 14401-99-1 | Molecular Weight | 315.28100 | |
| Density | 1.366g/cm3 | Boiling Point | 497.6ºC at 760 mmHg | |
| Molecular Formula | C15H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | 3,5-dinitro-N-(2-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 497.6ºC at 760 mmHg |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.28100 |
| Flash Point | 254.8ºC |
| Exact Mass | 315.08600 |
| PSA | 120.74000 |
| LogP | 3.91280 |
| Vapour Pressure | 4.86E-10mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | ZHEGDYUOFFUWED-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~46%
Benzamide,3,5-d... CAS#:14401-99-1 |
| Literature: Ito, Yoshikatsu; Arimoto, Satoru Journal of Physical Organic Chemistry, 2003 , vol. 16, # 11 p. 849 - 857 |
|
~%
Benzamide,3,5-d... CAS#:14401-99-1 |
| Literature: Munagala, Gurunadham; Yempalla, Kushalava Reddy; Aithagani, Sravan Kumar; Kalia, Nitin Pal; Ali, Furqan; Ali, Intzar; Rajput, Vikrant Singh; Rani, Chitra; Chib, Reena; Mehra, Rukmankesh; Nargotra, Ami; Khan, Inshad Ali; Vishwakarma, Ram A.; Singh, Parvinder Pal MedChemComm, 2014 , vol. 5, # 4 p. 521 - 527 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Phenethyl-3,5-dinitro-benzamid |
| 3,5-dinitro-N-phenethylbenzamide |