5-Thiazolecarboxylicacid,2-(4-fluorophenyl)-4-methyl- structure
|
Common Name | 5-Thiazolecarboxylicacid,2-(4-fluorophenyl)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 144060-99-1 | Molecular Weight | 237.250 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 417.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H8FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.0±31.5 °C | |
| Name | 2-(4-Fluorophenyl)-4-methyl-5-thiazolecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.0±55.0 °C at 760 mmHg |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.250 |
| Flash Point | 206.0±31.5 °C |
| Exact Mass | 237.025970 |
| PSA | 78.43000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | LPBSLIRPWIFCQT-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)O |
| HS Code | 2934100090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Thiazolecarboxylic acid, 2-(4-fluorophenyl)-4-methyl- |
| 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| 2-(4-Fluoro-phenyl)-4-methyl-thiazole-5-carboxylic acid |
| 5-Thiazolecarboxylicacid,2-(4-fluorophenyl)-4-methyl- |