1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate
Modify Date: 2026-07-22 04:52:35
1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate structure
|
Common Name | 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1440807-02-2 | Molecular Weight | 354.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16BrNO4 |
|---|---|
| Molecular Weight | 354.20 |
| InChIKey | IGNOOYDYYHQTEW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cc2c1ccn2C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: SMILES notation of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is COC(=O)c1cc(Br)cc2c1ccn2C(=O)OC(C)(C)C. |
| Q: What is the CAS number of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: CAS number of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is 1440807-02-2. |
| Q: What is the molecular formula of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: Molecular formula of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is C15H16BrNO4. |
| Q: What is the Chinese name of 1440807-02-2? |
| A: Chinese name of 1440807-02-2 is 1440807-02-2. |
| Q: What is the InChIKey of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: InChIKey of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is IGNOOYDYYHQTEW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: Molecular weight of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is 354.20. |
| Q: What is the English name of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate? |
| A: The English name of 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate is 1-(tert-butyl) 4-methyl 6-bromo-1H-indole-1,4-dicarboxylate. |