Agistatin E structure
|
Common Name | Agistatin E | ||
|---|---|---|---|---|
| CAS Number | 144096-48-0 | Molecular Weight | 228.242 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 382.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3±21.4 °C | |
Use of Agistatin EAgistatin E is a pyranacetal originally isolated from a Fusarium sp. that inhibits the cholesterol biosynthesis[1]. |
| Name | (1S,3R,6R,7R,8R)-6-Ethyl-3,8-dihydroxy-2,11-dioxatricyclo[5.3.1.03,8]undecan-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Agistatin E is a pyranacetal originally isolated from a Fusarium sp. that inhibits the cholesterol biosynthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.1±42.0 °C at 760 mmHg |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.242 |
| Flash Point | 150.3±21.4 °C |
| Exact Mass | 228.099777 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | NJLUHFDDAQPMDI-GSLIMFEQSA-N |
| SMILES | CCC1CCC2(O)OC3CC(=O)C2(O)C1O3 |
| 2,5-Epoxy-4H-1-benzopyran-4-one, 8-ethyloctahydro-4a,5-dihydroxy-, (2S,4aR,5R,8R,8aR)- |
| (1S,3R,6R,7R,8R)-6-Ethyl-3,8-dihydroxy-2,11-dioxatricyclo[5.3.1.03,8]undecan-9-one |