1-ethenoxy-3-nitrobenzene
1-ethenoxy-3-nitrobenzene structure
|
Common Name | 1-ethenoxy-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1441-07-2 | Molecular Weight | 165.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Ethenoxy-3-nitrobenzene (Chinese name: 1-乙氧基-3-硝基苯)， CAS number: 1441-07-2, molecular formula: C8H7NO3, molecular weight: 165.14600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-ethenoxy-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7NO3 |
|---|---|
| Molecular Weight | 165.14600 |
| Exact Mass | 165.04300 |
| PSA | 55.05000 |
| LogP | 2.64030 |
| InChIKey | AFQSAMFXXRPMLP-UHFFFAOYSA-N |
| SMILES | C=COc1cccc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-ethenoxy-3-ni... CAS#:1441-07-2 |
| Literature: McClelland,R.A. Canadian Journal of Chemistry, 1977 , vol. 55, p. 548 - 551 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Nitrophenylvinylether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-ethenoxy-3-nitrobenzene? |
| A: LogP of 1-ethenoxy-3-nitrobenzene is 2.64030. |
| Q: What is the InChIKey of 1-ethenoxy-3-nitrobenzene? |
| A: InChIKey of 1-ethenoxy-3-nitrobenzene is AFQSAMFXXRPMLP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-ethenoxy-3-nitrobenzene? |
| A: CAS number of 1-ethenoxy-3-nitrobenzene is 1441-07-2. |
| Q: What is the SMILES notation of 1-ethenoxy-3-nitrobenzene? |
| A: SMILES notation of 1-ethenoxy-3-nitrobenzene is C=COc1cccc([N+](=O)[O-])c1. |
| Q: What is the molecular weight of 1-ethenoxy-3-nitrobenzene? |
| A: Molecular weight of 1-ethenoxy-3-nitrobenzene is 165.14600. |
| Q: What is the English name of 1-ethenoxy-3-nitrobenzene? |
| A: The English name of 1-ethenoxy-3-nitrobenzene is 1-ethenoxy-3-nitrobenzene. |
| Q: What is the polar surface area (PSA) of 1-ethenoxy-3-nitrobenzene? |
| A: Polar surface area (PSA) of 1-ethenoxy-3-nitrobenzene is 55.05000. |
| Q: What English synonyms does 1-ethenoxy-3-nitrobenzene have? |
| A: English synonyms of 1-ethenoxy-3-nitrobenzene: p-Nitrophenylvinylether. |
| Q: What are the upstream materials of 1-ethenoxy-3-nitrobenzene? |
| A: Related upstream materials(CAS) of 1-ethenoxy-3-nitrobenzene: 554-84-7;106-93-4. |
| Q: What is the molecular formula of 1-ethenoxy-3-nitrobenzene? |
| A: Molecular formula of 1-ethenoxy-3-nitrobenzene is C8H7NO3. |