2-amino-9-(1,6-dihydroxyhexan-3-yl)-3H-purin-6-one structure
|
Common Name | 2-amino-9-(1,6-dihydroxyhexan-3-yl)-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 144175-45-1 | Molecular Weight | 267.28400 | |
| Density | 1.6g/cm3 | Boiling Point | 645.2ºC at 760 mmHg | |
| Molecular Formula | C11H17N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344ºC | |
| Name | 2-amino-9-(1,6-dihydroxyhexan-3-yl)-3H-purin-6-one |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 645.2ºC at 760 mmHg |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.28400 |
| Flash Point | 344ºC |
| Exact Mass | 267.13300 |
| PSA | 131.04000 |
| Vapour Pressure | 1.59E-17mmHg at 25°C |
| Index of Refraction | 1.72 |
| InChIKey | RDCKWBKGNSPMDR-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2C(CCO)CCCO)c(=O)[nH]1 |
|
~%
2-amino-9-(1,6-... CAS#:144175-45-1 |
| Literature: Legraverend; Boumchita; Bisagni Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 6 p. 1801 - 1804 |
|
~%
2-amino-9-(1,6-... CAS#:144175-45-1 |
| Literature: Legraverend; Boumchita; Bisagni Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 6 p. 1801 - 1804 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |