S-phenyl 2-phenylmethoxyethanethioate
S-phenyl 2-phenylmethoxyethanethioate structure
|
Common Name | S-phenyl 2-phenylmethoxyethanethioate | ||
|---|---|---|---|---|
| CAS Number | 144192-68-7 | Molecular Weight | 258.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: S-phenyl 2-phenylmethoxyethanethioate, Chinese name: S-苯基-2-苯基甲氧乙硫酸酯, CAS number: 144192-68-7, molecular formula: C15H14O2S, molecular weight: 258.33500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-phenyl 2-phenylmethoxyethanethioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O2S |
|---|---|
| Molecular Weight | 258.33500 |
| Exact Mass | 258.07100 |
| PSA | 51.60000 |
| LogP | 3.52210 |
| InChIKey | BLMSHQNHPDBMAP-UHFFFAOYSA-N |
| SMILES | O=C(COCc1ccccc1)Sc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
S-phenyl 2-phen... CAS#:144192-68-7 |
| Literature: Yost, Julianne M.; Zhou, Guoqiang; Coltart, Don M. Organic Letters, 2006 , vol. 8, # 7 p. 1503 - 1506 |
|
~%
S-phenyl 2-phen... CAS#:144192-68-7 |
| Literature: Gennari, Cesare; Vulpetti, Anna; Pain, Gilles Tetrahedron, 1997 , vol. 53, # 16 p. 5909 - 5924 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of S-phenyl 2-phenylmethoxyethanethioate? |
| A: The English name of S-phenyl 2-phenylmethoxyethanethioate is S-phenyl 2-phenylmethoxyethanethioate. |
| Q: What is the CAS number of S-phenyl 2-phenylmethoxyethanethioate? |
| A: CAS number of S-phenyl 2-phenylmethoxyethanethioate is 144192-68-7. |
| Q: What is the Chinese name of 144192-68-7? |
| A: Chinese name of 144192-68-7 is 144192-68-7. |
| Q: What is the InChIKey of S-phenyl 2-phenylmethoxyethanethioate? |
| A: InChIKey of S-phenyl 2-phenylmethoxyethanethioate is BLMSHQNHPDBMAP-UHFFFAOYSA-N. |
| Q: What are the upstream materials of S-phenyl 2-phenylmethoxyethanethioate? |
| A: Related upstream materials(CAS) of S-phenyl 2-phenylmethoxyethanethioate: 30379-55-6;108-98-5;19810-31-2. |
| Q: What is the SMILES notation of S-phenyl 2-phenylmethoxyethanethioate? |
| A: SMILES notation of S-phenyl 2-phenylmethoxyethanethioate is O=C(COCc1ccccc1)Sc1ccccc1. |
| Q: What is the LogP of S-phenyl 2-phenylmethoxyethanethioate? |
| A: LogP of S-phenyl 2-phenylmethoxyethanethioate is 3.52210. |
| Q: What is the polar surface area (PSA) of S-phenyl 2-phenylmethoxyethanethioate? |
| A: Polar surface area (PSA) of S-phenyl 2-phenylmethoxyethanethioate is 51.60000. |
| Q: What is the molecular formula of S-phenyl 2-phenylmethoxyethanethioate? |
| A: Molecular formula of S-phenyl 2-phenylmethoxyethanethioate is C15H14O2S. |
| Q: What is the molecular weight of S-phenyl 2-phenylmethoxyethanethioate? |
| A: Molecular weight of S-phenyl 2-phenylmethoxyethanethioate is 258.33500. |