1-(1,1,2,2-tetrafluoroethyl)cyclohexane-1-carboxylic acid structure
|
Common Name | 1-(1,1,2,2-tetrafluoroethyl)cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 144194-04-7 | Molecular Weight | 228.18400 | |
| Density | 1.322g/cm3 | Boiling Point | 266.7ºC at 760mmHg | |
| Molecular Formula | C9H12F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.1ºC | |
| Name | 1-(1,1,2,2-tetrafluoroethyl)cyclohexane-1-carboxylic acid |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 266.7ºC at 760mmHg |
| Molecular Formula | C9H12F4O2 |
| Molecular Weight | 228.18400 |
| Flash Point | 115.1ºC |
| Exact Mass | 228.07700 |
| PSA | 37.30000 |
| LogP | 2.92190 |
| Vapour Pressure | 0.00245mmHg at 25°C |
| Index of Refraction | 1.415 |
| InChIKey | LJIPDHDAWUUROB-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(C(F)(F)C(F)F)CCCCC1 |
|
~%
1-(1,1,2,2-tetr... CAS#:144194-04-7 |
| Literature: Crouse, Gary D.; Webster, Jeffery D. Journal of Organic Chemistry, 1992 , vol. 57, # 24 p. 6643 - 6646 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |