1,4-Naphthalenedione,2-chloro-3-(diethylamino)
Modify Date: 2025-09-09 13:15:38
1,4-Naphthalenedione,2-chloro-3-(diethylamino) structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-(diethylamino) | ||
|---|---|---|---|---|
| CAS Number | 14422-77-6 | Molecular Weight | 263.71900 | |
| Density | 1.27g/cm3 | Boiling Point | 345.6ºC at 760mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 2-chloro-3-(diethylamino)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 345.6ºC at 760mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 162.8ºC |
| Exact Mass | 263.07100 |
| PSA | 37.38000 |
| LogP | 2.85780 |
| Vapour Pressure | 6.08E-05mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | XUGFUJGRYIVAFD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(Cl)C(=O)c2ccccc2C1=O |
|
~37%
1,4-Naphthalene... CAS#:14422-77-6 |
| Literature: Blackburn, Christopher; Griffiths, John Journal of Chemical Research, Miniprint, 1983 , # 7 p. 1556 - 1574 |
|
~%
1,4-Naphthalene... CAS#:14422-77-6 |
| Literature: Kallmayer; Thierfelder Pharmazie, 2002 , vol. 57, # 7 p. 456 - 459 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-3-diaethylamino-naphthochinon-(1.4) |
| 2-Chlor-3-diethylamino-1,4-naphthochinon |
| 2-diethylamino-3-chloro-1,4-naphthoquinone |
| 2-Chlor-3-diaethylamino-[1,4]naphthochinon |
| 2-Chlor-3-diaethylamino-naphthochinon |
| 2-chloro-3-diethylamino-[1,4]naphthoquinone |