2-[[(Trifluoromethyl)sulfonyl]oxy]-1-cycloheptene-1-carboxylic acid ethyl ester structure
|
Common Name | 2-[[(Trifluoromethyl)sulfonyl]oxy]-1-cycloheptene-1-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 144242-09-1 | Molecular Weight | 316.29400 | |
| Density | 1.37 | Boiling Point | N/A | |
| Molecular Formula | C11H15F3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(((trifluoromethyl)sulfonyl)oxy)cyclohept-1-enecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37 |
|---|---|
| Molecular Formula | C11H15F3O5S |
| Molecular Weight | 316.29400 |
| Exact Mass | 316.05900 |
| PSA | 78.05000 |
| LogP | 3.71470 |
| InChIKey | RNQHHTQNNUOSDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CCCCC1 |
| HS Code | 2916209090 |
|---|
|
~%
2-[[(Trifluorom... CAS#:144242-09-1 |
| Literature: American Cyanamid Company Patent: US5968908 A1, 1999 ; |
|
~78%
2-[[(Trifluorom... CAS#:144242-09-1 |
| Literature: Crisp, Geoffrey T.; Meyer, Adam G. Journal of Organic Chemistry, 1992 , vol. 57, # 25 p. 6972 - 6975 |
|
~49%
2-[[(Trifluorom... CAS#:144242-09-1 |
| Literature: Watanabe, Norihiko; Tanino, Keiji; Kuwajima, Isao Tetrahedron Letters, 1999 , vol. 40, # 46 p. 8133 - 8136 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ethyl 2-(trifluoromethylsulfonyloxy)cycloheptene-1-carboxylate |