4-Hydroxybenzenepropanoic acid [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester structure
|
Common Name | 4-Hydroxybenzenepropanoic acid [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester | ||
|---|---|---|---|---|
| CAS Number | 144256-11-1 | Molecular Weight | 280.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 409.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9±19.4 °C | |
| Name | (S)-(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.2±35.0 °C at 760 mmHg |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.316 |
| Flash Point | 147.9±19.4 °C |
| Exact Mass | 280.131073 |
| PSA | 64.99000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | TWMFOGUTFPLVQZ-CYBMUJFWSA-N |
| SMILES | CC1(C)OCC(COC(=O)CCc2ccc(O)cc2)O1 |
| HS Code | 2932999099 |
|---|
|
~10%
4-Hydroxybenzen... CAS#:144256-11-1 |
| Literature: Iguchi; Iwamura; Nishizaki; Hayashi; Senokuchi; Kobayashi; Sakaki; Hachiya; Ichioka; Kawamura Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 6 p. 1462 - 1469 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzenepropanoic acid, 4-hydroxy-, [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester |
| [(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl 3-(4-hydroxyphenyl)propanoate |