4-methyl-N-[2-(3-oxocyclohexen-1-yl)ethyl]benzenesulfonamide structure
|
Common Name | 4-methyl-N-[2-(3-oxocyclohexen-1-yl)ethyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 144318-24-1 | Molecular Weight | 293.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-[2-(3-oxocyclohexen-1-yl)ethyl]benzenesulfonamide |
|---|
| Molecular Formula | C15H19NO3S |
|---|---|
| Molecular Weight | 293.38100 |
| Exact Mass | 293.10900 |
| PSA | 71.62000 |
| LogP | 3.81450 |
| InChIKey | NQBPGYVZSDGHER-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCC2=CC(=O)CCC2)cc1 |
|
~%
4-methyl-N-[2-(... CAS#:144318-24-1 |
| Literature: Parker, Kathlyn A.; Fokas, Demosthenes Journal of Organic Chemistry, 2006 , vol. 71, # 2 p. 449 - 455 |
|
~%
4-methyl-N-[2-(... CAS#:144318-24-1 |
| Literature: Parker, Kathlyn A.; Fokas, Demosthenes Journal of Organic Chemistry, 2006 , vol. 71, # 2 p. 449 - 455 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |