N-(2-chloropyridin-4-yl)nitramide structure
|
Common Name | N-(2-chloropyridin-4-yl)nitramide | ||
|---|---|---|---|---|
| CAS Number | 14432-13-4 | Molecular Weight | 173.55700 | |
| Density | 1.573 g/cm3 | Boiling Point | 317.4ºC at 760 mmHg | |
| Molecular Formula | C5H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.8ºC | |
| Name | N-(2-chloropyridin-4-yl)nitramide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573 g/cm3 |
|---|---|
| Boiling Point | 317.4ºC at 760 mmHg |
| Molecular Formula | C5H4ClN3O2 |
| Molecular Weight | 173.55700 |
| Flash Point | 145.8ºC |
| Exact Mass | 172.99900 |
| PSA | 70.74000 |
| LogP | 1.93480 |
| InChIKey | DRJOOIQTFYPKPR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])Nc1ccnc(Cl)c1 |
| HS Code | 2933399090 |
|---|
|
~%
N-(2-chloropyri... CAS#:14432-13-4 |
| Literature: Yin, Xueqiang; Schneller, Stewart W Nucleosides, nucleotides and nucleic acids, 2004 , vol. 23, # 1-2 p. 67 - 76 |
|
~86%
N-(2-chloropyri... CAS#:14432-13-4 |
| Literature: UNIVERSITY OF GEORGIA RESEARCH FOUNDATION, INC. Patent: WO2007/47793 A2, 2007 ; Location in patent: Page/Page column 86 ; |
|
~%
N-(2-chloropyri... CAS#:14432-13-4 |
| Literature: Talik; Plazek Roczniki Chemii, 1956 , vol. 30, p. 1139,1144 Chem.Abstr., 1957 , p. 12089 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitramino-2-chlor-pyridin |
| 2-Chloro-4-nitroaminopyridine |
| 2-chloro-4-nitroaaminopyridine |
| 2-chloro-N-nitropyridin-4-amine |
| 2-Chlor-4-nitramino-pyridin |