9(10H)-Acridinone, 6-amino-2-ethoxy structure
|
Common Name | 9(10H)-Acridinone, 6-amino-2-ethoxy | ||
|---|---|---|---|---|
| CAS Number | 144335-20-6 | Molecular Weight | 254.28400 | |
| Density | 1.262g/cm3 | Boiling Point | 490.4ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | 6-amino-2-ethoxy-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760 mmHg |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.28400 |
| Flash Point | 250.4ºC |
| Exact Mass | 254.10600 |
| PSA | 68.11000 |
| LogP | 3.24340 |
| Vapour Pressure | 9.19E-10mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | WLGUQMDSSWPOBE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2[nH]c3cc(N)ccc3c(=O)c2c1 |
|
~80%
9(10H)-Acridino... CAS#:144335-20-6 |
| Literature: Tatibouet; Demeunynck; Lhomme Synthetic Communications, 1996 , vol. 26, # 23 p. 4375 - 4395 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 6-amino-2-ethoxyacridin-9-ol |
| 6-amino-2-ethoxy-9-hydroxyacridine |