(2,3-dimethoxyphenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone structure
|
Common Name | (2,3-dimethoxyphenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 144344-71-8 | Molecular Weight | 283.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3-dimethoxyphenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
|---|
| Molecular Formula | C12H13NO3S2 |
|---|---|
| Molecular Weight | 283.36700 |
| Exact Mass | 283.03400 |
| PSA | 96.16000 |
| LogP | 2.11560 |
| InChIKey | KVEIOIFLZOKIEF-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)N2CCSC2=S)c1OC |
|
~82%
(2,3-dimethoxyp... CAS#:144344-71-8 |
| Literature: Karpishin; Dewey; Raymond Journal of the American Chemical Society, 1993 , vol. 115, # 5 p. 1842 - 1851 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |