1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine
Modify Date: 2026-09-23 17:36:33
1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine structure
|
Common Name | 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine | ||
|---|---|---|---|---|
| CAS Number | 1443773-07-6 | Molecular Weight | 189.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19N |
|---|---|
| Molecular Weight | 189.30 |
| InChIKey | QMRHNIUYBHBJBR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c2c1C(C)(C)CC2C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: SMILES notation of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is Cc1ccc(N)c2c1C(C)(C)CC2C. |
| Q: What is the CAS number of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: CAS number of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is 1443773-07-6. |
| Q: What is the English name of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: The English name of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine. |
| Q: What is the Chinese name of 1443773-07-6? |
| A: Chinese name of 1443773-07-6 is 1443773-07-6. |
| Q: What is the molecular weight of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: Molecular weight of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is 189.30. |
| Q: What is the molecular formula of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: Molecular formula of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is C13H19N. |
| Q: What is the InChIKey of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine? |
| A: InChIKey of 1,1,3,7-Tetramethyl-2,3-dihydro-1H-inden-4-amine is QMRHNIUYBHBJBR-UHFFFAOYSA-N. |