2-amino-4-(4-methylphenyl)-4H-benzo[h]chromene-3-carbonitrile structure
|
Common Name | 2-amino-4-(4-methylphenyl)-4H-benzo[h]chromene-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 144464-54-0 | Molecular Weight | 312.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-4-(4-methylphenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|
| Molecular Formula | C21H16N2O |
|---|---|
| Molecular Weight | 312.36500 |
| Exact Mass | 312.12600 |
| PSA | 59.04000 |
| LogP | 5.06668 |
| InChIKey | VOWWIDJXXXPMDR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2C(C#N)=C(N)Oc3c2ccc2ccccc32)cc1 |
|
~92%
2-amino-4-(4-me... CAS#:144464-54-0 |
| Literature: Mehrabi, Hossein; Kamali, Nafiseh Journal of the Iranian Chemical Society, 2012 , vol. 9, # 4 p. 599 - 605 |
|
~90%
2-amino-4-(4-me... CAS#:144464-54-0 |
| Literature: Harb, Abd-Elfattah A.; El-Maghraby, Awatef M.; Metwally, Saoud A. Collection of Czechoslovak Chemical Communications, 1992 , vol. 57, # 7 p. 1570 - 1574 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |