1-Propanone, 2,2-difluoro-1-(4-methoxyphenyl)- (9CI) structure
|
Common Name | 1-Propanone, 2,2-difluoro-1-(4-methoxyphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 144464-70-0 | Molecular Weight | 200.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-difluoro-1-(4-methoxyphenyl)propan-1-one |
|---|
| Molecular Formula | C10H10F2O2 |
|---|---|
| Molecular Weight | 200.18200 |
| Exact Mass | 200.06500 |
| PSA | 26.30000 |
| LogP | 2.53310 |
| InChIKey | HQYOCZCFHYGCKD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(C)(F)F)cc1 |
|
~%
1-Propanone, 2,... CAS#:144464-70-0 |
| Literature: Eguchi; Aoyama; Kakinuma Tetrahedron Letters, 1992 , vol. 33, # 38 p. 5545 - 5546 |
|
~%
1-Propanone, 2,... CAS#:144464-70-0 |
| Literature: Aoyama, Tetsuya; Eguchi, Tadashi; Oshima, Tairo; Kakinuma, Katsumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 15 p. 1905 - 1912 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |