2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate structure
|
Common Name | 2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate | ||
|---|---|---|---|---|
| CAS Number | 14450-05-6 | Molecular Weight | 697.03700 | |
| Density | 0.969g/cm3 | Boiling Point | 699.1ºC at 760mmHg | |
| Molecular Formula | C41H76O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | [3-nonanoyloxy-2,2-bis(nonanoyloxymethyl)propyl] nonanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.969g/cm3 |
|---|---|
| Boiling Point | 699.1ºC at 760mmHg |
| Molecular Formula | C41H76O8 |
| Molecular Weight | 697.03700 |
| Flash Point | 273.6ºC |
| Exact Mass | 696.55400 |
| PSA | 105.20000 |
| LogP | 11.14800 |
| Vapour Pressure | 2.16E-19mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | IBKKMFMBXQARGV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC |
| HS Code | 2915900090 |
|---|
|
~89%
2,2-bis[[(1-oxo... CAS#:14450-05-6 |
| Literature: Zhang, Fengxiu; Zhang, Guangxian Green Chemistry, 2011 , vol. 13, # 1 p. 178 - 184 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| tetra-O-nonanoyl-pentaerythritol |
| 2,2-dimiristoyloxymethyltrimethylene dimiristate |
| tetra-O-myristoyl-pentaerythritol |
| Pentaerythrityl tetramyristate |
| Tetradecanoic acid,2,2-bis(((1-oxotetradecyl)oxy)methyl)-1,3-propanediyl ester |
| pentaerythritol tetra-pelargonate |
| Pentaerythritol tetranonanoate |
| 2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate |
| pentaerythrityl tetrapelargonate |
| Tetra-O-nonanoyl-pentaerythrit |
| Myristic acid,tetraester with pentaerythritol |
| Pentaerythritol,tetramyristate |
| Tetra-O-myristoyl-pentaerythrit |