4-Acetyloxy-N,N-diallyltryptamine
Modify Date: 2026-07-16 18:27:41
4-Acetyloxy-N,N-diallyltryptamine structure
|
Common Name | 4-Acetyloxy-N,N-diallyltryptamine | ||
|---|---|---|---|---|
| CAS Number | 1445751-71-2 | Molecular Weight | 298.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Acetyloxy-N,N-diallyltryptamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22N2O2 |
|---|---|
| Molecular Weight | 298.4 |
| InChIKey | WRHFDIBXZYYCHO-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)CCc1c[nH]c2cccc(OC(C)=O)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: Molecular weight of 4-Acetyloxy-N,N-diallyltryptamine is 298.4. |
| Q: What is the English name of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: The English name of 4-Acetyloxy-N,N-diallyltryptamine is 4-Acetyloxy-N,N-diallyltryptamine. |
| Q: What is the InChIKey of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: InChIKey of 4-Acetyloxy-N,N-diallyltryptamine is WRHFDIBXZYYCHO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: Molecular formula of 4-Acetyloxy-N,N-diallyltryptamine is C18H22N2O2. |
| Q: What is the Chinese name of 1445751-71-2? |
| A: Chinese name of 1445751-71-2 is 1445751-71-2. |
| Q: What is the CAS number of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: CAS number of 4-Acetyloxy-N,N-diallyltryptamine is 1445751-71-2. |
| Q: What is the SMILES notation of 4-Acetyloxy-N,N-diallyltryptamine? |
| A: SMILES notation of 4-Acetyloxy-N,N-diallyltryptamine is C=CCN(CC=C)CCc1c[nH]c2cccc(OC(C)=O)c12. |