3'-O-tert-Butyldimethylsilyl-5'-O-DMT-N2-isobutyrylguanosine 2'-CE phosphoramidite structure
|
Common Name | 3'-O-tert-Butyldimethylsilyl-5'-O-DMT-N2-isobutyrylguanosine 2'-CE phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 1445905-51-0 | Molecular Weight | 970.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H68N7O9PSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-O-tert-Butyldimethylsilyl-5'-O-DMT-N2-isobutyrylguanosine 2'-CE phosphoramidite3'-TBDMS-ibu-rG Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | (2R,3R,4R,5R)-5-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)-2-(2-isobutyramido-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-TBDMS-ibu-rG Phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C50H68N7O9PSi |
|---|---|
| Molecular Weight | 970.18 |
| Exact Mass | 969.45900 |
| PSA | 197.90000 |
| LogP | 9.76198 |
| InChIKey | JCCWPNDXSMAHGZ-FTZVBZPOSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)C(OP(OCCC#N)N(C(C)C)C(C)C)C2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| MFCD30475539 |